C22H18N6O — CID 135954578
3-(1H-indol-3-yl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 135954578) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1H-indol-3-yl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135954578 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)c1cc(-c2c[nH]c3ccccc23)n[nH]1 |
| InChI | InChI=1S/C22H18N6O/c1-13-16(14-6-3-5-9-19(14)25-13)12-24-28-22(29)21-10-20(26-27-21)17-11-23-18-8-4-2-7-15(17)18/h2-12,23,25H,1H3,(H,26,27)(H,28,29)/b24-12- |
| InChIKey | OFOYVPFFZHQQJQ-MSXFZWOLSA-N |
| XLogP | 4.11 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|