C18H15N5OS — CID 696541
N-[(2-methyl-1H-indol-3-yl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 696541) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[(2-methyl-1H-indol-3-yl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(2-methyl-1H-indol-3-yl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 696541 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(2-methyl-1H-indol-3-yl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C=NNC(=O)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C18H15N5OS/c1-11-13(12-5-2-3-6-14(12)20-11)10-19-23-18(24)16-9-15(21-22-16)17-7-4-8-25-17/h2-10,20H,1H3,(H,21,22)(H,23,24) |
| InChIKey | UNRFJVJRIOQOAC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|