C16H12N4O3S — CID 761739
4-[[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]benzoic acid (PubChem CID 761739) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is 4-[[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 761739 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=NNC(=O)c2cc(-c3cccs3)[nH]n2)cc1 |
| InChI | InChI=1S/C16H12N4O3S/c21-15(13-8-12(18-19-13)14-2-1-7-24-14)20-17-9-10-3-5-11(6-4-10)16(22)23/h1-9H,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | MODJLDYPIMHSEF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|