C17H13BrN4OS — CID 6890728
N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 6890728) has the molecular formula C17H13BrN4OS and a molecular weight of 401.29 g/mol. Its IUPAC name is N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6890728 |
| Molecular Formula | C17H13BrN4OS |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C/C(Br)=C/c1ccccc1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C17H13BrN4OS/c18-13(9-12-5-2-1-3-6-12)11-19-22-17(23)15-10-14(20-21-15)16-7-4-8-24-16/h1-11H,(H,20,21)(H,22,23)/b13-9-,19-11+ |
| InChIKey | ZPKSUKMERKLIJI-FKDPSPLQSA-N |
| XLogP | 4.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|