C19H17N3O3S3 — CID 2594546
N-[(4-methylsulfanylphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2594546) has the molecular formula C19H17N3O3S3 and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(4-methylsulfanylphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2594546 |
| Molecular Formula | C19H17N3O3S3 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CSc1ccc(C=NNC(=O)c2ccccc2NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H17N3O3S3/c1-26-15-10-8-14(9-11-15)13-20-21-19(23)16-5-2-3-6-17(16)22-28(24,25)18-7-4-12-27-18/h2-13,22H,1H3,(H,21,23) |
| InChIKey | TTXRJYZCVQTSAR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|