C20H17N3O2S2 — CID 1284880
N-[2-[[(4-methylsulfanylphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 1284880) has the molecular formula C20H17N3O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[2-[[(4-methylsulfanylphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[(4-methylsulfanylphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1284880 |
| Molecular Formula | C20H17N3O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[2-[[(4-methylsulfanylphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CSc1ccc(C=NNC(=O)c2ccccc2NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H17N3O2S2/c1-26-15-10-8-14(9-11-15)13-21-23-19(24)16-5-2-3-6-17(16)22-20(25)18-7-4-12-27-18/h2-13H,1H3,(H,22,25)(H,23,24) |
| InChIKey | SSTZYSNOTSUBMZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|