C19H13Cl2N3O2S — CID 94844709
N-[2-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 94844709) has the molecular formula C19H13Cl2N3O2S and a molecular weight of 418.31 g/mol. Its IUPAC name is N-[2-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 94844709 |
| Molecular Formula | C19H13Cl2N3O2S |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | N-[2-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/N=C\c1c(Cl)cccc1Cl)c1cccs1 |
| InChI | InChI=1S/C19H13Cl2N3O2S/c20-14-6-3-7-15(21)13(14)11-22-24-18(25)12-5-1-2-8-16(12)23-19(26)17-9-4-10-27-17/h1-11H,(H,23,26)(H,24,25)/b22-11- |
| InChIKey | DWVDSKOWOCFYRD-JJFYIABZSA-N |
| XLogP | 5.07 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|