C21H14Cl2FN3O2 — CID 94831737
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide (PubChem CID 94831737) has the molecular formula C21H14Cl2FN3O2 and a molecular weight of 430.27 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 94831737 |
| Molecular Formula | C21H14Cl2FN3O2 |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/N=C\c1c(Cl)cccc1Cl)c1ccccc1F |
| InChI | InChI=1S/C21H14Cl2FN3O2/c22-16-8-5-9-17(23)15(16)12-25-27-21(29)14-7-2-4-11-19(14)26-20(28)13-6-1-3-10-18(13)24/h1-12H,(H,26,28)(H,27,29)/b25-12- |
| InChIKey | XEELQQHGKPTCCC-ROTLSHHCSA-N |
| XLogP | 5.15 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|