C13H12N2OS2 — CID 6878439
N-[(E)-(4-methylsulfanylphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 6878439) has the molecular formula C13H12N2OS2 and a molecular weight of 276.39 g/mol. Its IUPAC name is N-[(E)-(4-methylsulfanylphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(4-methylsulfanylphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6878439 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-[(E)-(4-methylsulfanylphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CSc1ccc(/C=N/NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H12N2OS2/c1-17-11-6-4-10(5-7-11)9-14-15-13(16)12-3-2-8-18-12/h2-9H,1H3,(H,15,16)/b14-9+ |
| InChIKey | QWELGMUGFFBQHL-NTEUORMPSA-N |
| XLogP | 3.23 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|