C14H14N2O3S — CID 2643472
N-[(3,5-dimethoxyphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 2643472) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2643472 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cccs2)cc(OC)c1 |
| InChI | InChI=1S/C14H14N2O3S/c1-18-11-6-10(7-12(8-11)19-2)9-15-16-14(17)13-4-3-5-20-13/h3-9H,1-2H3,(H,16,17) |
| InChIKey | JKJCGIWSUZUPNK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|