C15H16N2O2S — CID 4981001
N-[(4-methoxy-2,3-dimethylphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 4981001) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[(4-methoxy-2,3-dimethylphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(4-methoxy-2,3-dimethylphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4981001 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[(4-methoxy-2,3-dimethylphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2cccs2)c(C)c1C |
| InChI | InChI=1S/C15H16N2O2S/c1-10-11(2)13(19-3)7-6-12(10)9-16-17-15(18)14-5-4-8-20-14/h4-9H,1-3H3,(H,17,18) |
| InChIKey | FEDXSYSGIGBHIQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|