C18H21N3O3S — CID 126114114
N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 126114114) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126114114 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=N/NC(=O)c1cccs1 |
| InChI | InChI=1S/C18H21N3O3S/c1-23-15-11-14(21-7-3-4-8-21)16(24-2)10-13(15)12-19-20-18(22)17-6-5-9-25-17/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,20,22)/b19-12+ |
| InChIKey | TUOQIOVKDBQIML-XDHOZWIPSA-N |
| XLogP | 3.13 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|