C21H24N2O4 — CID 126108019
3-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-methylbenzoic acid (PubChem CID 126108019) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-methylbenzoic acid.
| Compound Name | 3-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 126108019 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-methylbenzoic acid |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=N/c1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C21H24N2O4/c1-14-16(21(24)25)7-6-8-17(14)22-13-15-11-20(27-3)18(12-19(15)26-2)23-9-4-5-10-23/h6-8,11-13H,4-5,9-10H2,1-3H3,(H,24,25)/b22-13+ |
| InChIKey | QJKUDUPXHSZGEE-LPYMAVHISA-N |
| XLogP | 4.06 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|