C21H24FN3O3 — CID 126252924
N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 126252924) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126252924 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=N/NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3O3/c1-27-19-13-18(25-9-3-4-10-25)20(28-2)12-16(19)14-23-24-21(26)11-15-5-7-17(22)8-6-15/h5-8,12-14H,3-4,9-11H2,1-2H3,(H,24,26)/b23-14+ |
| InChIKey | AVOXBIUUIHDXFS-OEAKJJBVSA-N |
| XLogP | 3.14 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|