C20H21ClN2O4 — CID 126091921
2-chloro-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]benzoic acid (PubChem CID 126091921) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-chloro-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]benzoic acid.
| Compound Name | 2-chloro-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 126091921 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-chloro-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]benzoic acid |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=N/c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-26-18-11-17(23-7-3-4-8-23)19(27-2)9-13(18)12-22-14-5-6-16(21)15(10-14)20(24)25/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,24,25)/b22-12+ |
| InChIKey | DJSALXGNABDUGS-WSDLNYQXSA-N |
| XLogP | 4.41 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|