C14H10ClNO3 — CID 17384577
5-[(2-chlorophenyl)methylideneamino]-2-hydroxybenzoic acid (PubChem CID 17384577) has the molecular formula C14H10ClNO3 and a molecular weight of 275.69 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylideneamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(2-chlorophenyl)methylideneamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 17384577 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 5-[(2-chlorophenyl)methylideneamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(/N=C/c2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C14H10ClNO3/c15-12-4-2-1-3-9(12)8-16-10-5-6-13(17)11(7-10)14(18)19/h1-8,17H,(H,18,19)/b16-8+ |
| InChIKey | XCKPCAXWYBQLOP-LZYBPNLTSA-N |
| XLogP | 3.49 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|