About carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+)
carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) (PubChem CID 135967304) has the molecular formula C15H16ClNOZr
and a molecular weight of 352.98 g/mol. Its IUPAC name is carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+).
Molecular Properties
| Compound Name | carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) |
| PubChem CID | 135967304 |
| Molecular Formula | C15H16ClNOZr |
| Molecular Weight | 352.98 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) |
| SMILES | Oc1c(Cl)cccc1/C=N/c1ccccc1.[CH3-].[CH3-].[Zr+2] |
| InChI | InChI=1S/C13H10ClNO.2CH3.Zr/c14-12-8-4-5-10(13(12)16)9-15-11-6-2-1-3-7-11;;;/h1-9,16H;2*1H3;/q;2*-1;+2/b15-9+;;; |
| InChIKey | ANMCRMNUHGPLPF-SFRYUHGMSA-N |
| XLogP | 4.69 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.98 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+)?
The IUPAC name of carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) (CID 135967304) is carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+).
What is the SMILES notation for carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+)?
The canonical SMILES for carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) is Oc1c(Cl)cccc1/C=N/c1ccccc1.[CH3-].[CH3-].[Zr+2].
What is the InChIKey of carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+)?
The InChIKey is ANMCRMNUHGPLPF-SFRYUHGMSA-N. The full InChI is InChI=1S/C13H10ClNO.2CH3.Zr/c14-12-8-4-5-10(13(12)16)9-15-11-6-2-1-3-7-11;;;/h1-9,16H;2*1H3;/q;2*-1;+2/b15-9+;;;.
What are the key properties of carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+)?
carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) has a molecular weight of 352.98 g/mol, XLogP of 4.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-chloro-6-(phenyliminomethyl)phenol;zirconium(2+) is sourced from PubChem (CID 135967304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).