About palladium;bis(2-(phenyliminomethyl)phenol)
palladium;bis(2-(phenyliminomethyl)phenol) (PubChem CID 162453521) has the molecular formula C26H22N2O2Pd
and a molecular weight of 500.89 g/mol. Its IUPAC name is palladium;bis(2-(phenyliminomethyl)phenol).
Molecular Properties
| Compound Name | palladium;bis(2-(phenyliminomethyl)phenol) |
| PubChem CID | 162453521 |
| Molecular Formula | C26H22N2O2Pd |
| Molecular Weight | 500.89 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | palladium;bis(2-(phenyliminomethyl)phenol) |
| SMILES | Oc1ccccc1/C=N/c1ccccc1.Oc1ccccc1/C=N/c1ccccc1.[Pd] |
| InChI | InChI=1S/2C13H11NO.Pd/c2*15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h2*1-10,15H;/b2*14-10+; |
| InChIKey | GCDKVSYSBILFGU-XGNDVENUSA-N |
| XLogP | 6.28 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.89 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze palladium;bis(2-(phenyliminomethyl)phenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(2-(phenyliminomethyl)phenol)?
The IUPAC name of palladium;bis(2-(phenyliminomethyl)phenol) (CID 162453521) is palladium;bis(2-(phenyliminomethyl)phenol).
What is the SMILES notation for palladium;bis(2-(phenyliminomethyl)phenol)?
The canonical SMILES for palladium;bis(2-(phenyliminomethyl)phenol) is Oc1ccccc1/C=N/c1ccccc1.Oc1ccccc1/C=N/c1ccccc1.[Pd].
What is the InChIKey of palladium;bis(2-(phenyliminomethyl)phenol)?
The InChIKey is GCDKVSYSBILFGU-XGNDVENUSA-N. The full InChI is InChI=1S/2C13H11NO.Pd/c2*15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h2*1-10,15H;/b2*14-10+;.
What are the key properties of palladium;bis(2-(phenyliminomethyl)phenol)?
palladium;bis(2-(phenyliminomethyl)phenol) has a molecular weight of 500.89 g/mol, XLogP of 6.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(2-(phenyliminomethyl)phenol) is sourced from PubChem (CID 162453521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).