C21H15N3O2 — CID 2302434
2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 2302434) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 2302434 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H15N3O2/c25-19-9-5-4-8-17(19)14-22-18-12-10-16(11-13-18)21-24-23-20(26-21)15-6-2-1-3-7-15/h1-14,25H/b22-14+ |
| InChIKey | VKIZRUSVHKIKLR-HYARGMPZSA-N |
| XLogP | 4.86 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|