About 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol
2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 2302434) has the molecular formula C21H15N3O2
and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol |
| PubChem CID | 2302434 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H15N3O2/c25-19-9-5-4-8-17(19)14-22-18-12-10-16(11-13-18)21-24-23-20(26-21)15-6-2-1-3-7-15/h1-14,25H/b22-14+ |
| InChIKey | VKIZRUSVHKIKLR-HYARGMPZSA-N |
| XLogP | 4.86 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol?
The IUPAC name of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol (CID 2302434) is 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol.
What is the SMILES notation for 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol?
The canonical SMILES for 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol is Oc1ccccc1/C=N/c1ccc(-c2nnc(-c3ccccc3)o2)cc1.
What is the InChIKey of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol?
The InChIKey is VKIZRUSVHKIKLR-HYARGMPZSA-N. The full InChI is InChI=1S/C21H15N3O2/c25-19-9-5-4-8-17(19)14-22-18-12-10-16(11-13-18)21-24-23-20(26-21)15-6-2-1-3-7-15/h1-14,25H/b22-14+.
What are the key properties of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol?
2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol has a molecular weight of 341.37 g/mol, XLogP of 4.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]iminomethyl]phenol is sourced from PubChem (CID 2302434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).