About dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol
dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol (PubChem CID 174611638) has the molecular formula C14H13Cl2NOZr
and a molecular weight of 373.39 g/mol. Its IUPAC name is dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol.
Molecular Properties
| Compound Name | dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol |
| PubChem CID | 174611638 |
| Molecular Formula | C14H13Cl2NOZr |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol |
| SMILES | Cc1cccc(/C=N/c2ccccc2)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C14H13NO.2ClH.Zr/c1-11-6-5-7-12(14(11)16)10-15-13-8-3-2-4-9-13;;;/h2-10,16H,1H3;2*1H;/q;;;+2/p-2/b15-10+;;; |
| InChIKey | YLIBRFDQRWWFHR-RJQKUYQSSA-L |
| XLogP | 4.83 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol?
The IUPAC name of dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol (CID 174611638) is dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol.
What is the SMILES notation for dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol?
The canonical SMILES for dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol is Cc1cccc(/C=N/c2ccccc2)c1O.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol?
The InChIKey is YLIBRFDQRWWFHR-RJQKUYQSSA-L. The full InChI is InChI=1S/C14H13NO.2ClH.Zr/c1-11-6-5-7-12(14(11)16)10-15-13-8-3-2-4-9-13;;;/h2-10,16H,1H3;2*1H;/q;;;+2/p-2/b15-10+;;;.
What are the key properties of dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol?
dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol has a molecular weight of 373.39 g/mol, XLogP of 4.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;2-methyl-6-(phenyliminomethyl)phenol is sourced from PubChem (CID 174611638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).