About 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium
2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium (PubChem CID 135997432) has the molecular formula C15H12Cl4N2NbO
and a molecular weight of 470.99 g/mol. Its IUPAC name is 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium.
Molecular Properties
| Compound Name | 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium |
| PubChem CID | 135997432 |
| Molecular Formula | C15H12Cl4N2NbO |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 468.88 |
| IUPAC Name | 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium |
| SMILES | Cl[Nb](Cl)(Cl)Cl.[C-]#[N+]c1cccc(/N=C/c2cccc(C)c2O)c1 |
| InChI | InChI=1S/C15H12N2O.4ClH.Nb/c1-11-5-3-6-12(15(11)18)10-17-14-8-4-7-13(9-14)16-2;;;;;/h3-10,18H,1H3;4*1H;/q;;;;;+4/p-4/b17-10+;;;;; |
| InChIKey | QOWDNSKATODLBX-TYCXPQSBSA-J |
| XLogP | 6.76 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium?
The IUPAC name of 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium (CID 135997432) is 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium.
What is the SMILES notation for 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium?
The canonical SMILES for 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium is Cl[Nb](Cl)(Cl)Cl.[C-]#[N+]c1cccc(/N=C/c2cccc(C)c2O)c1.
What is the InChIKey of 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium?
The InChIKey is QOWDNSKATODLBX-TYCXPQSBSA-J. The full InChI is InChI=1S/C15H12N2O.4ClH.Nb/c1-11-5-3-6-12(15(11)18)10-17-14-8-4-7-13(9-14)16-2;;;;;/h3-10,18H,1H3;4*1H;/q;;;;;+4/p-4/b17-10+;;;;;.
What are the key properties of 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium?
2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium has a molecular weight of 470.99 g/mol, XLogP of 6.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-isocyanophenyl)iminomethyl]-6-methylphenol;tetrachloroniobium is sourced from PubChem (CID 135997432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).