C11H10N4O — CID 135967228
2-methyl-6-[(E)-1,3,5-triazin-2-yliminomethyl]phenol (PubChem CID 135967228) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-methyl-6-[(E)-1,3,5-triazin-2-yliminomethyl]phenol.
| Compound Name | 2-methyl-6-[(E)-1,3,5-triazin-2-yliminomethyl]phenol |
|---|---|
| PubChem CID | 135967228 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-methyl-6-[(E)-1,3,5-triazin-2-yliminomethyl]phenol |
| SMILES | Cc1cccc(/C=N/c2ncncn2)c1O |
| InChI | InChI=1S/C11H10N4O/c1-8-3-2-4-9(10(8)16)5-13-11-14-6-12-7-15-11/h2-7,16H,1H3/b13-5+ |
| InChIKey | SEHSWTSOLWNVQW-WLRTZDKTSA-N |
| XLogP | 1.64 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|