About carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol
carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol (PubChem CID 135967147) has the molecular formula C16H18CrNO-
and a molecular weight of 292.32 g/mol. Its IUPAC name is carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol.
Molecular Properties
| Compound Name | carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol |
| PubChem CID | 135967147 |
| Molecular Formula | C16H18CrNO- |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol |
| SMILES | Cc1ccccc1/N=C/c1cccc(C)c1O.[CH3-].[Cr] |
| InChI | InChI=1S/C15H15NO.CH3.Cr/c1-11-6-3-4-9-14(11)16-10-13-8-5-7-12(2)15(13)17;;/h3-10,17H,1-2H3;1H3;/q;-1;/b16-10+;; |
| InChIKey | QYGNMBBWOFTFDX-CNSDMJOKSA-N |
| XLogP | 4.21 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol?
The IUPAC name of carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol (CID 135967147) is carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol.
What is the SMILES notation for carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol?
The canonical SMILES for carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol is Cc1ccccc1/N=C/c1cccc(C)c1O.[CH3-].[Cr].
What is the InChIKey of carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol?
The InChIKey is QYGNMBBWOFTFDX-CNSDMJOKSA-N. The full InChI is InChI=1S/C15H15NO.CH3.Cr/c1-11-6-3-4-9-14(11)16-10-13-8-5-7-12(2)15(13)17;;/h3-10,17H,1-2H3;1H3;/q;-1;/b16-10+;;.
What are the key properties of carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol?
carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol has a molecular weight of 292.32 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chromium;2-methyl-6-[(2-methylphenyl)iminomethyl]phenol is sourced from PubChem (CID 135967147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).