About 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum
2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum (PubChem CID 135967215) has the molecular formula C12H11Cl3N3OTa
and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum.
Molecular Properties
| Compound Name | 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum |
| PubChem CID | 135967215 |
| Molecular Formula | C12H11Cl3N3OTa |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 498.94 |
| IUPAC Name | 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum |
| SMILES | Cc1cccc(/C=N/c2ncccn2)c1O.Cl[Ta](Cl)Cl |
| InChI | InChI=1S/C12H11N3O.3ClH.Ta/c1-9-4-2-5-10(11(9)16)8-15-12-13-6-3-7-14-12;;;;/h2-8,16H,1H3;3*1H;/q;;;;+3/p-3/b15-8+;;;; |
| InChIKey | VRKUFRBUVUIWOS-BWUXSGITSA-K |
| XLogP | 4.31 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum?
The IUPAC name of 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum (CID 135967215) is 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum.
What is the SMILES notation for 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum?
The canonical SMILES for 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum is Cc1cccc(/C=N/c2ncccn2)c1O.Cl[Ta](Cl)Cl.
What is the InChIKey of 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum?
The InChIKey is VRKUFRBUVUIWOS-BWUXSGITSA-K. The full InChI is InChI=1S/C12H11N3O.3ClH.Ta/c1-9-4-2-5-10(11(9)16)8-15-12-13-6-3-7-14-12;;;;/h2-8,16H,1H3;3*1H;/q;;;;+3/p-3/b15-8+;;;;.
What are the key properties of 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum?
2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum has a molecular weight of 500.55 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[(E)-pyrimidin-2-yliminomethyl]phenol;trichlorotantalum is sourced from PubChem (CID 135967215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).