C19H22Cl2N2O2Zr — CID 135997406
dichlorozirconium;2-[3-[(2-hydroxy-3-methylphenyl)methylideneamino]propyliminomethyl]-6-methylphenol (PubChem CID 135997406) has the molecular formula C19H22Cl2N2O2Zr and a molecular weight of 472.53 g/mol. Its IUPAC name is dichlorozirconium;2-[3-[(2-hydroxy-3-methylphenyl)methylideneamino]propyliminomethyl]-6-methylphenol.
| Compound Name | dichlorozirconium;2-[3-[(2-hydroxy-3-methylphenyl)methylideneamino]propyliminomethyl]-6-methylphenol |
|---|---|
| PubChem CID | 135997406 |
| Molecular Formula | C19H22Cl2N2O2Zr |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | dichlorozirconium;2-[3-[(2-hydroxy-3-methylphenyl)methylideneamino]propyliminomethyl]-6-methylphenol |
| SMILES | Cc1cccc(/C=N/CCC/N=C/c2cccc(C)c2O)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C19H22N2O2.2ClH.Zr/c1-14-6-3-8-16(18(14)22)12-20-10-5-11-21-13-17-9-4-7-15(2)19(17)23;;;/h3-4,6-9,12-13,22-23H,5,10-11H2,1-2H3;2*1H;/q;;;+2/p-2/b20-12+,21-13+;;; |
| InChIKey | VTZBZYJFPPDRLN-LSLBEZLLSA-L |
| XLogP | 5.02 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|