C28H40Cl2N2O2Ti — CID 135979954
2-tert-butyl-6-[6-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]hexyliminomethyl]phenol;dichlorotitanium (PubChem CID 135979954) has the molecular formula C28H40Cl2N2O2Ti and a molecular weight of 555.41 g/mol. Its IUPAC name is 2-tert-butyl-6-[6-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]hexyliminomethyl]phenol;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-[6-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]hexyliminomethyl]phenol;dichlorotitanium |
|---|---|
| PubChem CID | 135979954 |
| Molecular Formula | C28H40Cl2N2O2Ti |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2-tert-butyl-6-[6-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]hexyliminomethyl]phenol;dichlorotitanium |
| SMILES | CC(C)(C)c1cccc(/C=N\CCCCCC/N=C/c2cccc(C(C)(C)C)c2O)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/C28H40N2O2.2ClH.Ti/c1-27(2,3)23-15-11-13-21(25(23)31)19-29-17-9-7-8-10-18-30-20-22-14-12-16-24(26(22)32)28(4,5)6;;;/h11-16,19-20,31-32H,7-10,17-18H2,1-6H3;2*1H;/q;;;+2/p-2/b29-19-,30-20+;;; |
| InChIKey | UECKMSRENDSJSW-OSQXZXISSA-L |
| XLogP | 8.17 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|