C20H24N2O4 — CID 609617
2-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]butyliminomethyl]-6-methoxyphenol (PubChem CID 609617) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]butyliminomethyl]-6-methoxyphenol.
| Compound Name | 2-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]butyliminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 609617 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]butyliminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/CCCC/N=C/c2cccc(OC)c2O)c1O |
| InChI | InChI=1S/C20H24N2O4/c1-25-17-9-5-7-15(19(17)23)13-21-11-3-4-12-22-14-16-8-6-10-18(26-2)20(16)24/h5-10,13-14,23-24H,3-4,11-12H2,1-2H3/b21-13+,22-14+ |
| InChIKey | PSJZCPKYFYKXHM-JFMUQQRKSA-N |
| XLogP | 3.43 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|