C18H20BrNO4 — CID 135855450
2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyliminomethyl]-6-methoxyphenol (PubChem CID 135855450) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyliminomethyl]-6-methoxyphenol.
| Compound Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyliminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135855450 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyliminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(Br)c(CC/N=C/c2cccc(OC)c2O)cc1OC |
| InChI | InChI=1S/C18H20BrNO4/c1-22-15-6-4-5-13(18(15)21)11-20-8-7-12-9-16(23-2)17(24-3)10-14(12)19/h4-6,9-11,21H,7-8H2,1-3H3/b20-11+ |
| InChIKey | YYPSWXFSTQKWHB-RGVLZGJSSA-N |
| XLogP | 3.84 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|