C16H16ClNO2 — CID 135757817
2-[2-(3-chlorophenyl)ethyliminomethyl]-6-methoxyphenol (PubChem CID 135757817) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethyliminomethyl]-6-methoxyphenol.
| Compound Name | 2-[2-(3-chlorophenyl)ethyliminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135757817 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethyliminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/CCc2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C16H16ClNO2/c1-20-15-7-3-5-13(16(15)19)11-18-9-8-12-4-2-6-14(17)10-12/h2-7,10-11,19H,8-9H2,1H3/b18-11+ |
| InChIKey | WAVRUJYWHWFUAU-WOJGMQOQSA-N |
| XLogP | 3.72 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|