C17H19NO4 — CID 135595556
2-[(3,4-dimethoxyphenyl)methyliminomethyl]-6-methoxyphenol (PubChem CID 135595556) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyliminomethyl]-6-methoxyphenol.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyliminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135595556 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyliminomethyl]-6-methoxyphenol |
| SMILES | COc1ccc(C/N=C/c2cccc(OC)c2O)cc1OC |
| InChI | InChI=1S/C17H19NO4/c1-20-14-8-7-12(9-16(14)22-3)10-18-11-13-5-4-6-15(21-2)17(13)19/h4-9,11,19H,10H2,1-3H3/b18-11+ |
| InChIKey | HETIOPVZHBODMD-WOJGMQOQSA-N |
| XLogP | 3.04 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|