C30H36N4O6 — CID 135509884
2-[2-[bis[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]amino]ethyliminomethyl]-6-methoxyphenol (PubChem CID 135509884) has the molecular formula C30H36N4O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is 2-[2-[bis[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]amino]ethyliminomethyl]-6-methoxyphenol.
| Compound Name | 2-[2-[bis[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]amino]ethyliminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135509884 |
| Molecular Formula | C30H36N4O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 2-[2-[bis[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]amino]ethyliminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/CCN(CC/N=C/c2cccc(OC)c2O)CC/N=C/c2cccc(OC)c2O)c1O |
| InChI | InChI=1S/C30H36N4O6/c1-38-25-10-4-7-22(28(25)35)19-31-13-16-34(17-14-32-20-23-8-5-11-26(39-2)29(23)36)18-15-33-21-24-9-6-12-27(40-3)30(24)37/h4-12,19-21,35-37H,13-18H2,1-3H3/b31-19+,32-20+,33-21+ |
| InChIKey | PAHKGNZYXXAXHA-TYUQYLRYSA-N |
| XLogP | 3.79 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|