C16H16ClNO2S — CID 135847622
2-[2-(4-chlorophenyl)sulfanylethyliminomethyl]-6-methoxyphenol (PubChem CID 135847622) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfanylethyliminomethyl]-6-methoxyphenol.
| Compound Name | 2-[2-(4-chlorophenyl)sulfanylethyliminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135847622 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfanylethyliminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/CCSc2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C16H16ClNO2S/c1-20-15-4-2-3-12(16(15)19)11-18-9-10-21-14-7-5-13(17)6-8-14/h2-8,11,19H,9-10H2,1H3/b18-11+ |
| InChIKey | QQLOZSMWNXCTDT-WOJGMQOQSA-N |
| XLogP | 4.27 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|