C18H18BrNO4 — CID 14565945
1-(1,3-benzodioxol-5-yl)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]methanimine (PubChem CID 14565945) has the molecular formula C18H18BrNO4 and a molecular weight of 392.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]methanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]methanimine |
|---|---|
| PubChem CID | 14565945 |
| Molecular Formula | C18H18BrNO4 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]methanimine |
| SMILES | COc1cc(Br)c(CC/N=C/c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C18H18BrNO4/c1-21-16-8-13(14(19)9-17(16)22-2)5-6-20-10-12-3-4-15-18(7-12)24-11-23-15/h3-4,7-10H,5-6,11H2,1-2H3/b20-10+ |
| InChIKey | QXQGVWPNQFADBO-KEBDBYFISA-N |
| XLogP | 3.86 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|