C20H19BrNO4+ — CID 102010457
6-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 102010457) has the molecular formula C20H19BrNO4+ and a molecular weight of 417.28 g/mol. Its IUPAC name is 6-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 6-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 102010457 |
| Molecular Formula | C20H19BrNO4+ |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 6-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | COc1cc(Br)c(CC[n+]2ccc3cc4c(cc3c2)OCO4)cc1OC |
| InChI | InChI=1S/C20H19BrNO4/c1-23-17-8-14(16(21)10-18(17)24-2)4-6-22-5-3-13-7-19-20(26-12-25-19)9-15(13)11-22/h3,5,7-11H,4,6,12H2,1-2H3/q+1 |
| InChIKey | KOZSHMMWEJLXHG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|