C11H16BrNO2 — CID 13212596
1-(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylmethanamine (PubChem CID 13212596) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 13212596 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylmethanamine |
| SMILES | COc1cc(Br)c(CN(C)C)cc1OC |
| InChI | InChI=1S/C11H16BrNO2/c1-13(2)7-8-5-10(14-3)11(15-4)6-9(8)12/h5-6H,7H2,1-4H3 |
| InChIKey | OLIQTZNTSFIJHO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |