C12H19BrN2O2 — CID 60888177
N'-[(2-bromo-4,5-dimethoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 60888177) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is N'-[(2-bromo-4,5-dimethoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(2-bromo-4,5-dimethoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60888177 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N'-[(2-bromo-4,5-dimethoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1cc(Br)c(CNCCCN)cc1OC |
| InChI | InChI=1S/C12H19BrN2O2/c1-16-11-6-9(8-15-5-3-4-14)10(13)7-12(11)17-2/h6-7,15H,3-5,8,14H2,1-2H3 |
| InChIKey | KDKVENUOZXONLW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|