C13H18BrNO2 — CID 113465465
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]but-3-en-1-amine (PubChem CID 113465465) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]but-3-en-1-amine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 113465465 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]but-3-en-1-amine |
| SMILES | C=CCCNCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C13H18BrNO2/c1-4-5-6-15-9-10-7-12(16-2)13(17-3)8-11(10)14/h4,7-8,15H,1,5-6,9H2,2-3H3 |
| InChIKey | OFYLVECAQSZJSE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|