C12H19BrN2O4S — CID 102674833
2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-N-methylethanesulfonamide (PubChem CID 102674833) has the molecular formula C12H19BrN2O4S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102674833 |
| Molecular Formula | C12H19BrN2O4S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C12H19BrN2O4S/c1-14-20(16,17)5-4-15-8-9-6-11(18-2)12(19-3)7-10(9)13/h6-7,14-15H,4-5,8H2,1-3H3 |
| InChIKey | JCNQVHYEAJYFSV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|