C8H12Br2N2O2S2 — CID 106333932
2-[(4,5-dibromothiophen-2-yl)methylamino]-N-methylethanesulfonamide (PubChem CID 106333932) has the molecular formula C8H12Br2N2O2S2 and a molecular weight of 392.14 g/mol. Its IUPAC name is 2-[(4,5-dibromothiophen-2-yl)methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[(4,5-dibromothiophen-2-yl)methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106333932 |
| Molecular Formula | C8H12Br2N2O2S2 |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 389.87 |
| IUPAC Name | 2-[(4,5-dibromothiophen-2-yl)methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H12Br2N2O2S2/c1-11-16(13,14)3-2-12-5-6-4-7(9)8(10)15-6/h4,11-12H,2-3,5H2,1H3 |
| InChIKey | VEXWVNJJGBYDLJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|