C13H14Br2N2O2S2 — CID 102835092
4-[2-[(4,5-dibromothiophen-2-yl)methylamino]ethyl]benzenesulfonamide (PubChem CID 102835092) has the molecular formula C13H14Br2N2O2S2 and a molecular weight of 454.21 g/mol. Its IUPAC name is 4-[2-[(4,5-dibromothiophen-2-yl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(4,5-dibromothiophen-2-yl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102835092 |
| Molecular Formula | C13H14Br2N2O2S2 |
| Molecular Weight | 454.21 g/mol |
| Exact Mass | 451.89 |
| IUPAC Name | 4-[2-[(4,5-dibromothiophen-2-yl)methylamino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C13H14Br2N2O2S2/c14-12-7-10(20-13(12)15)8-17-6-5-9-1-3-11(4-2-9)21(16,18)19/h1-4,7,17H,5-6,8H2,(H2,16,18,19) |
| InChIKey | PXVFNPNTJFHWQF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|