C19H20BrClN2O3S — CID 17332241
4-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 17332241) has the molecular formula C19H20BrClN2O3S and a molecular weight of 471.80 g/mol. Its IUPAC name is 4-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 17332241 |
| Molecular Formula | C19H20BrClN2O3S |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 4-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccc(CCNCc2ccc(-c3ccc(Br)cc3)o2)cc1 |
| InChI | InChI=1S/C19H19BrN2O3S.ClH/c20-16-5-3-15(4-6-16)19-10-7-17(25-19)13-22-12-11-14-1-8-18(9-2-14)26(21,23)24;/h1-10,22H,11-13H2,(H2,21,23,24);1H |
| InChIKey | GMRTZFGQRXRKOP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|