C20H19ClN2O5S — CID 17212952
4-chloro-3-[5-[[2-(4-sulfamoylphenyl)ethylamino]methyl]furan-2-yl]benzoic acid (PubChem CID 17212952) has the molecular formula C20H19ClN2O5S and a molecular weight of 434.90 g/mol. Its IUPAC name is 4-chloro-3-[5-[[2-(4-sulfamoylphenyl)ethylamino]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[[2-(4-sulfamoylphenyl)ethylamino]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 17212952 |
| Molecular Formula | C20H19ClN2O5S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 4-chloro-3-[5-[[2-(4-sulfamoylphenyl)ethylamino]methyl]furan-2-yl]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2ccc(-c3cc(C(=O)O)ccc3Cl)o2)cc1 |
| InChI | InChI=1S/C20H19ClN2O5S/c21-18-7-3-14(20(24)25)11-17(18)19-8-4-15(28-19)12-23-10-9-13-1-5-16(6-2-13)29(22,26)27/h1-8,11,23H,9-10,12H2,(H,24,25)(H2,22,26,27) |
| InChIKey | XAWXSNMDVQAXIA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|