C17H14ClNO4 — CID 17212980
4-chloro-3-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid (PubChem CID 17212980) has the molecular formula C17H14ClNO4 and a molecular weight of 331.75 g/mol. Its IUPAC name is 4-chloro-3-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 17212980 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-chloro-3-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2ccc(CNCc3ccco3)o2)c1 |
| InChI | InChI=1S/C17H14ClNO4/c18-15-5-3-11(17(20)21)8-14(15)16-6-4-13(23-16)10-19-9-12-2-1-7-22-12/h1-8,19H,9-10H2,(H,20,21) |
| InChIKey | SQJWXMOBJPGUAD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |