C19H16ClNO3 — CID 17212798
3-[5-[[(2-chlorophenyl)methylamino]methyl]furan-2-yl]benzoic acid (PubChem CID 17212798) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 3-[5-[[(2-chlorophenyl)methylamino]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[[(2-chlorophenyl)methylamino]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 17212798 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-[5-[[(2-chlorophenyl)methylamino]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(CNCc3ccccc3Cl)o2)c1 |
| InChI | InChI=1S/C19H16ClNO3/c20-17-7-2-1-4-15(17)11-21-12-16-8-9-18(24-16)13-5-3-6-14(10-13)19(22)23/h1-10,21H,11-12H2,(H,22,23) |
| InChIKey | FECWLWRASBWSPG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |