C16H20ClNO4 — CID 17212789
3-[5-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17212789) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is 3-[5-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 3-[5-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17212789 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-[5-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | CC(C)(CO)NCc1ccc(-c2cccc(C(=O)O)c2)o1.Cl |
| InChI | InChI=1S/C16H19NO4.ClH/c1-16(2,10-18)17-9-13-6-7-14(21-13)11-4-3-5-12(8-11)15(19)20;/h3-8,17-18H,9-10H2,1-2H3,(H,19,20);1H |
| InChIKey | WKHNJDJTCRRJTP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |