C17H20ClNO4 — CID 17212805
3-[5-[(oxolan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17212805) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is 3-[5-[(oxolan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 3-[5-[(oxolan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17212805 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-[5-[(oxolan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cccc(-c2ccc(CNCC3CCCO3)o2)c1 |
| InChI | InChI=1S/C17H19NO4.ClH/c19-17(20)13-4-1-3-12(9-13)16-7-6-15(22-16)11-18-10-14-5-2-8-21-14;/h1,3-4,6-7,9,14,18H,2,5,8,10-11H2,(H,19,20);1H |
| InChIKey | YDHNJLJYXQTQEV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |