C12H17NO3 — CID 45093757
2-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diol (PubChem CID 45093757) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diol.
| Compound Name | 2-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 45093757 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1CNCC1CCCO1 |
| InChI | InChI=1S/C12H17NO3/c14-11-4-1-5-12(15)10(11)8-13-7-9-3-2-6-16-9/h1,4-5,9,13-15H,2-3,6-8H2 |
| InChIKey | RMRYTRGOZFTGKV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|