C18H21NO4 — CID 8636615
methyl 4-[5-[[[(2S)-oxolan-2-yl]methylamino]methyl]furan-2-yl]benzoate (PubChem CID 8636615) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 4-[5-[[[(2S)-oxolan-2-yl]methylamino]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[[(2S)-oxolan-2-yl]methylamino]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 8636615 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl 4-[5-[[[(2S)-oxolan-2-yl]methylamino]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(CNC[C@@H]3CCCO3)o2)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-21-18(20)14-6-4-13(5-7-14)17-9-8-16(23-17)12-19-11-15-3-2-10-22-15/h4-9,15,19H,2-3,10-12H2,1H3/t15-/m0/s1 |
| InChIKey | SVZFMPFNBBHWHO-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |