C16H21Cl2NO4 — CID 17332913
methyl 4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoate;dihydrochloride (PubChem CID 17332913) has the molecular formula C16H21Cl2NO4 and a molecular weight of 362.25 g/mol. Its IUPAC name is methyl 4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoate;dihydrochloride.
| Compound Name | methyl 4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoate;dihydrochloride |
|---|---|
| PubChem CID | 17332913 |
| Molecular Formula | C16H21Cl2NO4 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | methyl 4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoate;dihydrochloride |
| SMILES | COCCNCc1ccc(-c2ccc(C(=O)OC)cc2)o1.Cl.Cl |
| InChI | InChI=1S/C16H19NO4.2ClH/c1-19-10-9-17-11-14-7-8-15(21-14)12-3-5-13(6-4-12)16(18)20-2;;/h3-8,17H,9-11H2,1-2H3;2*1H |
| InChIKey | FPFBRDBMPCDZCJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|