C19H28Cl2N2O4 — CID 17331156
ethyl 4-[5-[[2-(2-hydroxypropylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride (PubChem CID 17331156) has the molecular formula C19H28Cl2N2O4 and a molecular weight of 419.35 g/mol. Its IUPAC name is ethyl 4-[5-[[2-(2-hydroxypropylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride.
| Compound Name | ethyl 4-[5-[[2-(2-hydroxypropylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride |
|---|---|
| PubChem CID | 17331156 |
| Molecular Formula | C19H28Cl2N2O4 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 4-[5-[[2-(2-hydroxypropylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride |
| SMILES | CCOC(=O)c1ccc(-c2ccc(CNCCNCC(C)O)o2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H26N2O4.2ClH/c1-3-24-19(23)16-6-4-15(5-7-16)18-9-8-17(25-18)13-21-11-10-20-12-14(2)22;;/h4-9,14,20-22H,3,10-13H2,1-2H3;2*1H |
| InChIKey | HQZVSRODTDLHHE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|